About N-chlorohex-2-enamide
N-chlorohex-2-enamide (PubChem CID 140536866) has the molecular formula C6H10ClNO
and a molecular weight of 147.60 g/mol. Its IUPAC name is N-chlorohex-2-enamide.
Molecular Properties
| Compound Name | N-chlorohex-2-enamide |
| PubChem CID | 140536866 |
| Molecular Formula | C6H10ClNO |
| Molecular Weight | 147.60 g/mol |
| Exact Mass | 147.05 |
| IUPAC Name | N-chlorohex-2-enamide |
| SMILES | CCCC=CC(=O)NCl |
| InChI | InChI=1S/C6H10ClNO/c1-2-3-4-5-6(9)8-7/h4-5H,2-3H2,1H3,(H,8,9) |
| InChIKey | UPCINUIVUOUEME-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.60 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-chlorohex-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-chlorohex-2-enamide?
The IUPAC name of N-chlorohex-2-enamide (CID 140536866) is N-chlorohex-2-enamide.
What is the SMILES notation for N-chlorohex-2-enamide?
The canonical SMILES for N-chlorohex-2-enamide is CCCC=CC(=O)NCl.
What is the InChIKey of N-chlorohex-2-enamide?
The InChIKey is UPCINUIVUOUEME-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10ClNO/c1-2-3-4-5-6(9)8-7/h4-5H,2-3H2,1H3,(H,8,9).
What are the key properties of N-chlorohex-2-enamide?
N-chlorohex-2-enamide has a molecular weight of 147.60 g/mol, XLogP of 1.61, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-chlorohex-2-enamide is sourced from PubChem (CID 140536866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).