About S-ethyl (E)-hex-2-enethioate
S-ethyl (E)-hex-2-enethioate (PubChem CID 11400929) has the molecular formula C8H14OS
and a molecular weight of 158.27 g/mol. Its IUPAC name is S-ethyl (E)-hex-2-enethioate.
Molecular Properties
| Compound Name | S-ethyl (E)-hex-2-enethioate |
| PubChem CID | 11400929 |
| Molecular Formula | C8H14OS |
| Molecular Weight | 158.27 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | S-ethyl (E)-hex-2-enethioate |
| SMILES | CCC/C=C/C(=O)SCC |
| InChI | InChI=1S/C8H14OS/c1-3-5-6-7-8(9)10-4-2/h6-7H,3-5H2,1-2H3/b7-6+ |
| InChIKey | OJHZEUDEHMUUNR-VOTSOKGWSA-N |
| XLogP | 2.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.27 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-ethyl (E)-hex-2-enethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-ethyl (E)-hex-2-enethioate?
The IUPAC name of S-ethyl (E)-hex-2-enethioate (CID 11400929) is S-ethyl (E)-hex-2-enethioate.
What is the SMILES notation for S-ethyl (E)-hex-2-enethioate?
The canonical SMILES for S-ethyl (E)-hex-2-enethioate is CCC/C=C/C(=O)SCC.
What is the InChIKey of S-ethyl (E)-hex-2-enethioate?
The InChIKey is OJHZEUDEHMUUNR-VOTSOKGWSA-N. The full InChI is InChI=1S/C8H14OS/c1-3-5-6-7-8(9)10-4-2/h6-7H,3-5H2,1-2H3/b7-6+.
What are the key properties of S-ethyl (E)-hex-2-enethioate?
S-ethyl (E)-hex-2-enethioate has a molecular weight of 158.27 g/mol, XLogP of 2.62, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-ethyl (E)-hex-2-enethioate is sourced from PubChem (CID 11400929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).