C9H19ClN2O — CID 172860490
N-chlorohex-2-enamide;N,N-dimethylmethanamine (PubChem CID 172860490) has the molecular formula C9H19ClN2O and a molecular weight of 206.72 g/mol. Its IUPAC name is N-chlorohex-2-enamide;N,N-dimethylmethanamine.
| Compound Name | N-chlorohex-2-enamide;N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 172860490 |
| Molecular Formula | C9H19ClN2O |
| Molecular Weight | 206.72 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | N-chlorohex-2-enamide;N,N-dimethylmethanamine |
| SMILES | CCCC=CC(=O)NCl.CN(C)C |
| InChI | InChI=1S/C6H10ClNO.C3H9N/c1-2-3-4-5-6(9)8-7;1-4(2)3/h4-5H,2-3H2,1H3,(H,8,9);1-3H3 |
| InChIKey | ZGZGXPVHQBPICO-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.72 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|