C21H39N3O2 — CID 141294013
(Z)-2-[2-(carbamoylamino)ethenyl]octadec-9-enamide (PubChem CID 141294013) has the molecular formula C21H39N3O2 and a molecular weight of 365.56 g/mol. Its IUPAC name is (Z)-2-[2-(carbamoylamino)ethenyl]octadec-9-enamide.
| Compound Name | (Z)-2-[2-(carbamoylamino)ethenyl]octadec-9-enamide |
|---|---|
| PubChem CID | 141294013 |
| Molecular Formula | C21H39N3O2 |
| Molecular Weight | 365.56 g/mol |
| Exact Mass | 365.30 |
| IUPAC Name | (Z)-2-[2-(carbamoylamino)ethenyl]octadec-9-enamide |
| SMILES | CCCCCCCC/C=C\CCCCCCC(C=CNC(N)=O)C(N)=O |
| InChI | InChI=1S/C21H39N3O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19(20(22)25)17-18-24-21(23)26/h9-10,17-19H,2-8,11-16H2,1H3,(H2,22,25)(H3,23,24,26)/b10-9-,18-17? |
| InChIKey | QBTSSWKBFREAJB-RWARRFCWSA-N |
| XLogP | 4.92 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.56 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|