C14H15NO4 — CID 101234990
methyl 4-[[(1E)-buta-1,3-dienyl]carbamoyloxymethyl]benzoate (PubChem CID 101234990) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is methyl 4-[[(1E)-buta-1,3-dienyl]carbamoyloxymethyl]benzoate.
| Compound Name | methyl 4-[[(1E)-buta-1,3-dienyl]carbamoyloxymethyl]benzoate |
|---|---|
| PubChem CID | 101234990 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | methyl 4-[[(1E)-buta-1,3-dienyl]carbamoyloxymethyl]benzoate |
| SMILES | C=C/C=C/NC(=O)OCc1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C14H15NO4/c1-3-4-9-15-14(17)19-10-11-5-7-12(8-6-11)13(16)18-2/h3-9H,1,10H2,2H3,(H,15,17)/b9-4+ |
| InChIKey | XSRQTSWSJDUHOP-RUDMXATFSA-N |
| XLogP | 2.40 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|