C7H8N4O — CID 16679784
N-[(Z)-2-amino-1,2-dicyanoethenyl]propanamide (PubChem CID 16679784) has the molecular formula C7H8N4O and a molecular weight of 164.17 g/mol. Its IUPAC name is N-[(Z)-2-amino-1,2-dicyanoethenyl]propanamide.
| Compound Name | N-[(Z)-2-amino-1,2-dicyanoethenyl]propanamide |
|---|---|
| PubChem CID | 16679784 |
| Molecular Formula | C7H8N4O |
| Molecular Weight | 164.17 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | N-[(Z)-2-amino-1,2-dicyanoethenyl]propanamide |
| SMILES | CCC(=O)N/C(C#N)=C(\N)C#N |
| InChI | InChI=1S/C7H8N4O/c1-2-7(12)11-6(4-9)5(10)3-8/h2,10H2,1H3,(H,11,12)/b6-5- |
| InChIKey | XPVDTPVZMPQHJP-WAYWQWQTSA-N |
| XLogP | -0.27 |
| TPSA | 102.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.17 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|