About N-[(Z)-2-amino-1,2-dicyanoethenyl]propanamide
N-[(Z)-2-amino-1,2-dicyanoethenyl]propanamide (PubChem CID 16679784) has the molecular formula C7H8N4O
and a molecular weight of 164.17 g/mol. Its IUPAC name is N-[(Z)-2-amino-1,2-dicyanoethenyl]propanamide.
Molecular Properties
| Compound Name | N-[(Z)-2-amino-1,2-dicyanoethenyl]propanamide |
| PubChem CID | 16679784 |
| Molecular Formula | C7H8N4O |
| Molecular Weight | 164.17 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | N-[(Z)-2-amino-1,2-dicyanoethenyl]propanamide |
| SMILES | CCC(=O)N/C(C#N)=C(\N)C#N |
| InChI | InChI=1S/C7H8N4O/c1-2-7(12)11-6(4-9)5(10)3-8/h2,10H2,1H3,(H,11,12)/b6-5- |
| InChIKey | XPVDTPVZMPQHJP-WAYWQWQTSA-N |
| XLogP | -0.27 |
| TPSA | 102.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.17 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-2-amino-1,2-dicyanoethenyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-2-amino-1,2-dicyanoethenyl]propanamide?
The IUPAC name of N-[(Z)-2-amino-1,2-dicyanoethenyl]propanamide (CID 16679784) is N-[(Z)-2-amino-1,2-dicyanoethenyl]propanamide.
What is the SMILES notation for N-[(Z)-2-amino-1,2-dicyanoethenyl]propanamide?
The canonical SMILES for N-[(Z)-2-amino-1,2-dicyanoethenyl]propanamide is CCC(=O)N/C(C#N)=C(\N)C#N.
What is the InChIKey of N-[(Z)-2-amino-1,2-dicyanoethenyl]propanamide?
The InChIKey is XPVDTPVZMPQHJP-WAYWQWQTSA-N. The full InChI is InChI=1S/C7H8N4O/c1-2-7(12)11-6(4-9)5(10)3-8/h2,10H2,1H3,(H,11,12)/b6-5-.
What are the key properties of N-[(Z)-2-amino-1,2-dicyanoethenyl]propanamide?
N-[(Z)-2-amino-1,2-dicyanoethenyl]propanamide has a molecular weight of 164.17 g/mol, XLogP of -0.27, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-2-amino-1,2-dicyanoethenyl]propanamide is sourced from PubChem (CID 16679784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).