C17H13N5O — CID 57474704
1-[(Z)-2-amino-1,2-dicyanoethenyl]-3-(2-phenylphenyl)urea (PubChem CID 57474704) has the molecular formula C17H13N5O and a molecular weight of 303.33 g/mol. Its IUPAC name is 1-[(Z)-2-amino-1,2-dicyanoethenyl]-3-(2-phenylphenyl)urea.
| Compound Name | 1-[(Z)-2-amino-1,2-dicyanoethenyl]-3-(2-phenylphenyl)urea |
|---|---|
| PubChem CID | 57474704 |
| Molecular Formula | C17H13N5O |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 1-[(Z)-2-amino-1,2-dicyanoethenyl]-3-(2-phenylphenyl)urea |
| SMILES | N#C/C(N)=C(\C#N)NC(=O)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C17H13N5O/c18-10-14(20)16(11-19)22-17(23)21-15-9-5-4-8-13(15)12-6-2-1-3-7-12/h1-9H,20H2,(H2,21,22,23)/b16-14- |
| InChIKey | PMXVZWVCOWQCBB-PEZBUJJGSA-N |
| XLogP | 2.69 |
| TPSA | 114.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|