C20H19N5O4 — CID 141219476
1-[(Z)-2-amino-1,2-dicyanoethenyl]-3-(2-methoxyphenyl)urea;methyl benzoate (PubChem CID 141219476) has the molecular formula C20H19N5O4 and a molecular weight of 393.40 g/mol. Its IUPAC name is 1-[(Z)-2-amino-1,2-dicyanoethenyl]-3-(2-methoxyphenyl)urea;methyl benzoate.
| Compound Name | 1-[(Z)-2-amino-1,2-dicyanoethenyl]-3-(2-methoxyphenyl)urea;methyl benzoate |
|---|---|
| PubChem CID | 141219476 |
| Molecular Formula | C20H19N5O4 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 1-[(Z)-2-amino-1,2-dicyanoethenyl]-3-(2-methoxyphenyl)urea;methyl benzoate |
| SMILES | COC(=O)c1ccccc1.COc1ccccc1NC(=O)N/C(C#N)=C(\N)C#N |
| InChI | InChI=1S/C12H11N5O2.C8H8O2/c1-19-11-5-3-2-4-9(11)16-12(18)17-10(7-14)8(15)6-13;1-10-8(9)7-5-3-2-4-6-7/h2-5H,15H2,1H3,(H2,16,17,18);2-6H,1H3/b10-8-; |
| InChIKey | BKXLDAOVRUAUQI-DQMXGCRQSA-N |
| XLogP | 2.51 |
| TPSA | 150.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|