C12H8F3N5O2 — CID 57474553
1-[(Z)-2-amino-1,2-dicyanoethenyl]-3-[2-(trifluoromethoxy)phenyl]urea (PubChem CID 57474553) has the molecular formula C12H8F3N5O2 and a molecular weight of 311.22 g/mol. Its IUPAC name is 1-[(Z)-2-amino-1,2-dicyanoethenyl]-3-[2-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[(Z)-2-amino-1,2-dicyanoethenyl]-3-[2-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 57474553 |
| Molecular Formula | C12H8F3N5O2 |
| Molecular Weight | 311.22 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 1-[(Z)-2-amino-1,2-dicyanoethenyl]-3-[2-(trifluoromethoxy)phenyl]urea |
| SMILES | N#C/C(N)=C(\C#N)NC(=O)Nc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C12H8F3N5O2/c13-12(14,15)22-10-4-2-1-3-8(10)19-11(21)20-9(6-17)7(18)5-16/h1-4H,18H2,(H2,19,20,21)/b9-7- |
| InChIKey | YIIRAYAKTMMRHN-CLFYSBASSA-N |
| XLogP | 1.92 |
| TPSA | 123.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.22 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|