C10H6F7NO2 — CID 103732361
2,2,3,3-tetrafluoro-N-[2-(trifluoromethoxy)phenyl]propanamide (PubChem CID 103732361) has the molecular formula C10H6F7NO2 and a molecular weight of 305.15 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-[2-(trifluoromethoxy)phenyl]propanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-[2-(trifluoromethoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 103732361 |
| Molecular Formula | C10H6F7NO2 |
| Molecular Weight | 305.15 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-[2-(trifluoromethoxy)phenyl]propanamide |
| SMILES | O=C(Nc1ccccc1OC(F)(F)F)C(F)(F)C(F)F |
| InChI | InChI=1S/C10H6F7NO2/c11-7(12)9(13,14)8(19)18-5-3-1-2-4-6(5)20-10(15,16)17/h1-4,7H,(H,18,19) |
| InChIKey | YHBDQEPKHOSLGO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.15 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|