C13H15F4NO2 — CID 103733060
2,2,3,3-tetrafluoro-N-[2-(2-methylpropoxy)phenyl]propanamide (PubChem CID 103733060) has the molecular formula C13H15F4NO2 and a molecular weight of 293.26 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-[2-(2-methylpropoxy)phenyl]propanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-[2-(2-methylpropoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 103733060 |
| Molecular Formula | C13H15F4NO2 |
| Molecular Weight | 293.26 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-[2-(2-methylpropoxy)phenyl]propanamide |
| SMILES | CC(C)COc1ccccc1NC(=O)C(F)(F)C(F)F |
| InChI | InChI=1S/C13H15F4NO2/c1-8(2)7-20-10-6-4-3-5-9(10)18-12(19)13(16,17)11(14)15/h3-6,8,11H,7H2,1-2H3,(H,18,19) |
| InChIKey | VYTULEJZLCWVPI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.26 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|