C11H10F4N2O2 — CID 103732853
N-[2-(2-amino-2-oxoethyl)phenyl]-2,2,3,3-tetrafluoropropanamide (PubChem CID 103732853) has the molecular formula C11H10F4N2O2 and a molecular weight of 278.20 g/mol. Its IUPAC name is N-[2-(2-amino-2-oxoethyl)phenyl]-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-[2-(2-amino-2-oxoethyl)phenyl]-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 103732853 |
| Molecular Formula | C11H10F4N2O2 |
| Molecular Weight | 278.20 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | N-[2-(2-amino-2-oxoethyl)phenyl]-2,2,3,3-tetrafluoropropanamide |
| SMILES | NC(=O)Cc1ccccc1NC(=O)C(F)(F)C(F)F |
| InChI | InChI=1S/C11H10F4N2O2/c12-9(13)11(14,15)10(19)17-7-4-2-1-3-6(7)5-8(16)18/h1-4,9H,5H2,(H2,16,18)(H,17,19) |
| InChIKey | ACNLAWANRUTOIB-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.20 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|