C9H12N4O — CID 10704573
N-[(Z)-2-amino-1,2-dicyanoethenyl]pentanamide (PubChem CID 10704573) has the molecular formula C9H12N4O and a molecular weight of 192.22 g/mol. Its IUPAC name is N-[(Z)-2-amino-1,2-dicyanoethenyl]pentanamide.
| Compound Name | N-[(Z)-2-amino-1,2-dicyanoethenyl]pentanamide |
|---|---|
| PubChem CID | 10704573 |
| Molecular Formula | C9H12N4O |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | N-[(Z)-2-amino-1,2-dicyanoethenyl]pentanamide |
| SMILES | CCCCC(=O)N/C(C#N)=C(\N)C#N |
| InChI | InChI=1S/C9H12N4O/c1-2-3-4-9(14)13-8(6-11)7(12)5-10/h2-4,12H2,1H3,(H,13,14)/b8-7- |
| InChIKey | NLBQXNRGUOGRRK-FPLPWBNLSA-N |
| XLogP | 0.51 |
| TPSA | 102.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|