C12H11N5O3S — CID 11044948
1-[(Z)-2-amino-1,2-dicyanoethenyl]-3-(4-methylphenyl)sulfonylurea (PubChem CID 11044948) has the molecular formula C12H11N5O3S and a molecular weight of 305.32 g/mol. Its IUPAC name is 1-[(Z)-2-amino-1,2-dicyanoethenyl]-3-(4-methylphenyl)sulfonylurea.
| Compound Name | 1-[(Z)-2-amino-1,2-dicyanoethenyl]-3-(4-methylphenyl)sulfonylurea |
|---|---|
| PubChem CID | 11044948 |
| Molecular Formula | C12H11N5O3S |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 1-[(Z)-2-amino-1,2-dicyanoethenyl]-3-(4-methylphenyl)sulfonylurea |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)N/C(C#N)=C(\N)C#N)cc1 |
| InChI | InChI=1S/C12H11N5O3S/c1-8-2-4-9(5-3-8)21(19,20)17-12(18)16-11(7-14)10(15)6-13/h2-5H,15H2,1H3,(H2,16,17,18)/b11-10- |
| InChIKey | MWYDOQNLINQMTP-KHPPLWFESA-N |
| XLogP | 0.20 |
| TPSA | 148.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|