C18H22N6O6S4 — CID 161247510
1-carbamothioyl-3-(4-methylphenyl)sulfonylurea;4-methyl-N-(oxomethylidene)benzenesulfonamide;thiourea (PubChem CID 161247510) has the molecular formula C18H22N6O6S4 and a molecular weight of 546.68 g/mol. Its IUPAC name is 1-carbamothioyl-3-(4-methylphenyl)sulfonylurea;4-methyl-N-(oxomethylidene)benzenesulfonamide;thiourea.
| Compound Name | 1-carbamothioyl-3-(4-methylphenyl)sulfonylurea;4-methyl-N-(oxomethylidene)benzenesulfonamide;thiourea |
|---|---|
| PubChem CID | 161247510 |
| Molecular Formula | C18H22N6O6S4 |
| Molecular Weight | 546.68 g/mol |
| Exact Mass | 546.05 |
| IUPAC Name | 1-carbamothioyl-3-(4-methylphenyl)sulfonylurea;4-methyl-N-(oxomethylidene)benzenesulfonamide;thiourea |
| SMILES | Cc1ccc(S(=O)(=O)N=C=O)cc1.Cc1ccc(S(=O)(=O)NC(=O)NC(N)=S)cc1.NC(N)=S |
| InChI | InChI=1S/C9H11N3O3S2.C8H7NO3S.CH4N2S/c1-6-2-4-7(5-3-6)17(14,15)12-9(13)11-8(10)16;1-7-2-4-8(5-3-7)13(11,12)9-6-10;2-1(3)4/h2-5H,1H3,(H4,10,11,12,13,16);2-5H,1H3;(H4,2,3,4) |
| InChIKey | VAVHCGGIZZHCSU-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 216.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.68 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|