C15H17N3O5S2 — CID 87849852
4-methylbenzenesulfonohydrazide;2-methyl-N-(oxomethylidene)benzenesulfonamide (PubChem CID 87849852) has the molecular formula C15H17N3O5S2 and a molecular weight of 383.45 g/mol. Its IUPAC name is 4-methylbenzenesulfonohydrazide;2-methyl-N-(oxomethylidene)benzenesulfonamide.
| Compound Name | 4-methylbenzenesulfonohydrazide;2-methyl-N-(oxomethylidene)benzenesulfonamide |
|---|---|
| PubChem CID | 87849852 |
| Molecular Formula | C15H17N3O5S2 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | 4-methylbenzenesulfonohydrazide;2-methyl-N-(oxomethylidene)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NN)cc1.Cc1ccccc1S(=O)(=O)N=C=O |
| InChI | InChI=1S/C8H7NO3S.C7H10N2O2S/c1-7-4-2-3-5-8(7)13(11,12)9-6-10;1-6-2-4-7(5-3-6)12(10,11)9-8/h2-5H,1H3;2-5,9H,8H2,1H3 |
| InChIKey | MLFYXSUSJFGOLC-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 135.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|