C9H9NO3S — CID 15232647
2,5-dimethyl-N-(oxomethylidene)benzenesulfonamide (PubChem CID 15232647) has the molecular formula C9H9NO3S and a molecular weight of 211.24 g/mol. Its IUPAC name is 2,5-dimethyl-N-(oxomethylidene)benzenesulfonamide.
| Compound Name | 2,5-dimethyl-N-(oxomethylidene)benzenesulfonamide |
|---|---|
| PubChem CID | 15232647 |
| Molecular Formula | C9H9NO3S |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.03 |
| IUPAC Name | 2,5-dimethyl-N-(oxomethylidene)benzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N=C=O)c1 |
| InChI | InChI=1S/C9H9NO3S/c1-7-3-4-8(2)9(5-7)14(12,13)10-6-11/h3-5H,1-2H3 |
| InChIKey | HCPYEBKRJIBAAV-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|