C15H13Cl2NO2S — CID 885300
4-chloro-N-(2,5-dimethylphenyl)sulfonylbenzenecarboximidoyl chloride (PubChem CID 885300) has the molecular formula C15H13Cl2NO2S and a molecular weight of 342.25 g/mol. Its IUPAC name is 4-chloro-N-(2,5-dimethylphenyl)sulfonylbenzenecarboximidoyl chloride.
| Compound Name | 4-chloro-N-(2,5-dimethylphenyl)sulfonylbenzenecarboximidoyl chloride |
|---|---|
| PubChem CID | 885300 |
| Molecular Formula | C15H13Cl2NO2S |
| Molecular Weight | 342.25 g/mol |
| Exact Mass | 341.00 |
| IUPAC Name | 4-chloro-N-(2,5-dimethylphenyl)sulfonylbenzenecarboximidoyl chloride |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N=C(Cl)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C15H13Cl2NO2S/c1-10-3-4-11(2)14(9-10)21(19,20)18-15(17)12-5-7-13(16)8-6-12/h3-9H,1-2H3 |
| InChIKey | WCLOQSDEXRUVKI-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.25 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|