C11H8N3NaO2S2 — CID 135050883
sodium 2,2-dicyano-1-[(4-methylphenyl)sulfonylamino]ethenethiolate (PubChem CID 135050883) has the molecular formula C11H8N3NaO2S2 and a molecular weight of 301.33 g/mol. Its IUPAC name is sodium 2,2-dicyano-1-[(4-methylphenyl)sulfonylamino]ethenethiolate.
| Compound Name | sodium 2,2-dicyano-1-[(4-methylphenyl)sulfonylamino]ethenethiolate |
|---|---|
| PubChem CID | 135050883 |
| Molecular Formula | C11H8N3NaO2S2 |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.00 |
| IUPAC Name | sodium 2,2-dicyano-1-[(4-methylphenyl)sulfonylamino]ethenethiolate |
| SMILES | Cc1ccc(S(=O)(=O)NC([S-])=C(C#N)C#N)cc1.[Na+] |
| InChI | InChI=1S/C11H9N3O2S2.Na/c1-8-2-4-10(5-3-8)18(15,16)14-11(17)9(6-12)7-13;/h2-5,14,17H,1H3;/q;+1/p-1 |
| InChIKey | DMDYBIMXMRPEBI-UHFFFAOYSA-M |
| XLogP | -1.92 |
| TPSA | 93.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|