C10H12N2O4 — CID 22157614
N,N'-bis[(E)-but-2-enoyl]oxamide (PubChem CID 22157614) has the molecular formula C10H12N2O4 and a molecular weight of 224.22 g/mol. Its IUPAC name is N,N'-bis[(E)-but-2-enoyl]oxamide.
| Compound Name | N,N'-bis[(E)-but-2-enoyl]oxamide |
|---|---|
| PubChem CID | 22157614 |
| Molecular Formula | C10H12N2O4 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | N,N'-bis[(E)-but-2-enoyl]oxamide |
| SMILES | C/C=C/C(=O)NC(=O)C(=O)NC(=O)/C=C/C |
| InChI | InChI=1S/C10H12N2O4/c1-3-5-7(13)11-9(15)10(16)12-8(14)6-4-2/h3-6H,1-2H3,(H,11,13,15)(H,12,14,16)/b5-3+,6-4+ |
| InChIKey | LZXBKJXIPRKTEF-GGWOSOGESA-N |
| XLogP | -0.58 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|