C10H17NO2 — CID 143631553
N-[(2R,3E)-3-ethenylhexa-3,5-dien-2-yl]formamide;methanol (PubChem CID 143631553) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is N-[(2R,3E)-3-ethenylhexa-3,5-dien-2-yl]formamide;methanol.
| Compound Name | N-[(2R,3E)-3-ethenylhexa-3,5-dien-2-yl]formamide;methanol |
|---|---|
| PubChem CID | 143631553 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | N-[(2R,3E)-3-ethenylhexa-3,5-dien-2-yl]formamide;methanol |
| SMILES | C=C/C=C(\C=C)[C@@H](C)NC=O.CO |
| InChI | InChI=1S/C9H13NO.CH4O/c1-4-6-9(5-2)8(3)10-7-11;1-2/h4-8H,1-2H2,3H3,(H,10,11);2H,1H3/b9-6+;/t8-;/m1./s1 |
| InChIKey | YTBQVKSRFUWTAX-LZYGEERSSA-N |
| XLogP | 1.03 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|