C10H19NO — CID 142354278
(E,2S,3S)-2-amino-4-ethenylhex-4-en-3-ol;ethene (PubChem CID 142354278) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is (E,2S,3S)-2-amino-4-ethenylhex-4-en-3-ol;ethene.
| Compound Name | (E,2S,3S)-2-amino-4-ethenylhex-4-en-3-ol;ethene |
|---|---|
| PubChem CID | 142354278 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | (E,2S,3S)-2-amino-4-ethenylhex-4-en-3-ol;ethene |
| SMILES | C=C.C=C/C(=C\C)[C@H](O)[C@H](C)N |
| InChI | InChI=1S/C8H15NO.C2H4/c1-4-7(5-2)8(10)6(3)9;1-2/h4-6,8,10H,1,9H2,2-3H3;1-2H2/b7-5+;/t6-,8+;/m0./s1 |
| InChIKey | HIBWVSFPUCGRHO-WTZKYOJSSA-N |
| XLogP | 1.63 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|