C6H16N2 — CID 161476573
propane-1,2-diamine;prop-1-ene (PubChem CID 161476573) has the molecular formula C6H16N2 and a molecular weight of 116.21 g/mol. Its IUPAC name is propane-1,2-diamine;prop-1-ene.
| Compound Name | propane-1,2-diamine;prop-1-ene |
|---|---|
| PubChem CID | 161476573 |
| Molecular Formula | C6H16N2 |
| Molecular Weight | 116.21 g/mol |
| Exact Mass | 116.13 |
| IUPAC Name | propane-1,2-diamine;prop-1-ene |
| SMILES | C=CC.CC(N)CN |
| InChI | InChI=1S/C3H10N2.C3H6/c1-3(5)2-4;1-3-2/h3H,2,4-5H2,1H3;3H,1H2,2H3 |
| InChIKey | WDUHACNKXYIOAB-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.21 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|