C15H27NO2 — CID 166883604
[(3Z)-2,2-dimethylhexa-3,5-dien-3-yl] (2S)-4-methyl-2-(methylamino)pentanoate (PubChem CID 166883604) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is [(3Z)-2,2-dimethylhexa-3,5-dien-3-yl] (2S)-4-methyl-2-(methylamino)pentanoate.
| Compound Name | [(3Z)-2,2-dimethylhexa-3,5-dien-3-yl] (2S)-4-methyl-2-(methylamino)pentanoate |
|---|---|
| PubChem CID | 166883604 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | [(3Z)-2,2-dimethylhexa-3,5-dien-3-yl] (2S)-4-methyl-2-(methylamino)pentanoate |
| SMILES | C=C/C=C(\OC(=O)[C@H](CC(C)C)NC)C(C)(C)C |
| InChI | InChI=1S/C15H27NO2/c1-8-9-13(15(4,5)6)18-14(17)12(16-7)10-11(2)3/h8-9,11-12,16H,1,10H2,2-7H3/b13-9-/t12-/m0/s1 |
| InChIKey | HIDJPCIVVHBGOU-VWLVURMCSA-N |
| XLogP | 3.28 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|