About 3-oxo-2-phenylpropanoate
3-oxo-2-phenylpropanoate (PubChem CID 18187381) has the molecular formula C9H7O3-
and a molecular weight of 163.15 g/mol. Its IUPAC name is 3-oxo-2-phenylpropanoate.
Molecular Properties
| Compound Name | 3-oxo-2-phenylpropanoate |
| PubChem CID | 18187381 |
| Molecular Formula | C9H7O3- |
| Molecular Weight | 163.15 g/mol |
| Exact Mass | 163.04 |
| IUPAC Name | 3-oxo-2-phenylpropanoate |
| SMILES | O=CC(C(=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C9H8O3/c10-6-8(9(11)12)7-4-2-1-3-5-7/h1-6,8H,(H,11,12)/p-1 |
| InChIKey | DDTOOANXAAWWQJ-UHFFFAOYSA-M |
| XLogP | -0.28 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.15 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-oxo-2-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxo-2-phenylpropanoate?
The IUPAC name of 3-oxo-2-phenylpropanoate (CID 18187381) is 3-oxo-2-phenylpropanoate.
What is the SMILES notation for 3-oxo-2-phenylpropanoate?
The canonical SMILES for 3-oxo-2-phenylpropanoate is O=CC(C(=O)[O-])c1ccccc1.
What is the InChIKey of 3-oxo-2-phenylpropanoate?
The InChIKey is DDTOOANXAAWWQJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H8O3/c10-6-8(9(11)12)7-4-2-1-3-5-7/h1-6,8H,(H,11,12)/p-1.
What are the key properties of 3-oxo-2-phenylpropanoate?
3-oxo-2-phenylpropanoate has a molecular weight of 163.15 g/mol, XLogP of -0.28, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxo-2-phenylpropanoate is sourced from PubChem (CID 18187381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).