About 3-oxo-2,4-diphenylpentanedithial
3-oxo-2,4-diphenylpentanedithial (PubChem CID 174886605) has the molecular formula C17H14OS2
and a molecular weight of 298.43 g/mol. Its IUPAC name is 3-oxo-2,4-diphenylpentanedithial.
Molecular Properties
| Compound Name | 3-oxo-2,4-diphenylpentanedithial |
| PubChem CID | 174886605 |
| Molecular Formula | C17H14OS2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 3-oxo-2,4-diphenylpentanedithial |
| SMILES | O=C(C(C=S)c1ccccc1)C(C=S)c1ccccc1 |
| InChI | InChI=1S/C17H14OS2/c18-17(15(11-19)13-7-3-1-4-8-13)16(12-20)14-9-5-2-6-10-14/h1-12,15-16H |
| InChIKey | QGLBXXAGLLRALJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-oxo-2,4-diphenylpentanedithial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxo-2,4-diphenylpentanedithial?
The IUPAC name of 3-oxo-2,4-diphenylpentanedithial (CID 174886605) is 3-oxo-2,4-diphenylpentanedithial.
What is the SMILES notation for 3-oxo-2,4-diphenylpentanedithial?
The canonical SMILES for 3-oxo-2,4-diphenylpentanedithial is O=C(C(C=S)c1ccccc1)C(C=S)c1ccccc1.
What is the InChIKey of 3-oxo-2,4-diphenylpentanedithial?
The InChIKey is QGLBXXAGLLRALJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14OS2/c18-17(15(11-19)13-7-3-1-4-8-13)16(12-20)14-9-5-2-6-10-14/h1-12,15-16H.
What are the key properties of 3-oxo-2,4-diphenylpentanedithial?
3-oxo-2,4-diphenylpentanedithial has a molecular weight of 298.43 g/mol, XLogP of 4.12, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxo-2,4-diphenylpentanedithial is sourced from PubChem (CID 174886605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).