C5H8F3NO3 — CID 87355573
1-oxopropan-2-ylazanium;2,2,2-trifluoroacetate (PubChem CID 87355573) has the molecular formula C5H8F3NO3 and a molecular weight of 187.12 g/mol. Its IUPAC name is 1-oxopropan-2-ylazanium;2,2,2-trifluoroacetate.
| Compound Name | 1-oxopropan-2-ylazanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87355573 |
| Molecular Formula | C5H8F3NO3 |
| Molecular Weight | 187.12 g/mol |
| Exact Mass | 187.05 |
| IUPAC Name | 1-oxopropan-2-ylazanium;2,2,2-trifluoroacetate |
| SMILES | CC([NH3+])C=O.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C3H7NO.C2HF3O2/c1-3(4)2-5;3-2(4,5)1(6)7/h2-3H,4H2,1H3;(H,6,7) |
| InChIKey | KEKNHNULTHVFEF-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.12 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|