C5H11NO3 — CID 86308698
(2R,3S)-2-azaniumyl-3-hydroxypentanoate (PubChem CID 86308698) has the molecular formula C5H11NO3 and a molecular weight of 133.15 g/mol. Its IUPAC name is (2R,3S)-2-azaniumyl-3-hydroxypentanoate.
| Compound Name | (2R,3S)-2-azaniumyl-3-hydroxypentanoate |
|---|---|
| PubChem CID | 86308698 |
| Molecular Formula | C5H11NO3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.07 |
| IUPAC Name | (2R,3S)-2-azaniumyl-3-hydroxypentanoate |
| SMILES | CC[C@H](O)[C@@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C5H11NO3/c1-2-3(7)4(6)5(8)9/h3-4,7H,2,6H2,1H3,(H,8,9)/t3-,4+/m0/s1 |
| InChIKey | LGVJIYCMHMKTPB-IUYQGCFVSA-N |
| XLogP | -2.88 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |