About (2S,3S)-2,6-bis(azaniumyl)-3-hydroxyhexanoate
(2S,3S)-2,6-bis(azaniumyl)-3-hydroxyhexanoate (PubChem CID 86289230) has the molecular formula C6H15N2O3+
and a molecular weight of 163.20 g/mol. Its IUPAC name is (2S,3S)-2,6-bis(azaniumyl)-3-hydroxyhexanoate.
Molecular Properties
| Compound Name | (2S,3S)-2,6-bis(azaniumyl)-3-hydroxyhexanoate |
| PubChem CID | 86289230 |
| Molecular Formula | C6H15N2O3+ |
| Molecular Weight | 163.20 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | (2S,3S)-2,6-bis(azaniumyl)-3-hydroxyhexanoate |
| SMILES | [NH3+]CCC[C@H](O)[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C6H14N2O3/c7-3-1-2-4(9)5(8)6(10)11/h4-5,9H,1-3,7-8H2,(H,10,11)/p+1/t4-,5-/m0/s1 |
| InChIKey | YSVMULOOWPBERR-WHFBIAKZSA-O |
| XLogP | -4.27 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.20 |
| LogP ≤ 5 | -4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S,3S)-2,6-bis(azaniumyl)-3-hydroxyhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-2,6-bis(azaniumyl)-3-hydroxyhexanoate?
The IUPAC name of (2S,3S)-2,6-bis(azaniumyl)-3-hydroxyhexanoate (CID 86289230) is (2S,3S)-2,6-bis(azaniumyl)-3-hydroxyhexanoate.
What is the SMILES notation for (2S,3S)-2,6-bis(azaniumyl)-3-hydroxyhexanoate?
The canonical SMILES for (2S,3S)-2,6-bis(azaniumyl)-3-hydroxyhexanoate is [NH3+]CCC[C@H](O)[C@H]([NH3+])C(=O)[O-].
What is the InChIKey of (2S,3S)-2,6-bis(azaniumyl)-3-hydroxyhexanoate?
The InChIKey is YSVMULOOWPBERR-WHFBIAKZSA-O. The full InChI is InChI=1S/C6H14N2O3/c7-3-1-2-4(9)5(8)6(10)11/h4-5,9H,1-3,7-8H2,(H,10,11)/p+1/t4-,5-/m0/s1.
What are the key properties of (2S,3S)-2,6-bis(azaniumyl)-3-hydroxyhexanoate?
(2S,3S)-2,6-bis(azaniumyl)-3-hydroxyhexanoate has a molecular weight of 163.20 g/mol, XLogP of -4.27, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-2,6-bis(azaniumyl)-3-hydroxyhexanoate is sourced from PubChem (CID 86289230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).