C11H23N3O6 — CID 158540866
2-azaniumylpentanedioate;2,6-bis(azaniumyl)hexanoate (PubChem CID 158540866) has the molecular formula C11H23N3O6 and a molecular weight of 293.32 g/mol. Its IUPAC name is 2-azaniumylpentanedioate;2,6-bis(azaniumyl)hexanoate.
| Compound Name | 2-azaniumylpentanedioate;2,6-bis(azaniumyl)hexanoate |
|---|---|
| PubChem CID | 158540866 |
| Molecular Formula | C11H23N3O6 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 2-azaniumylpentanedioate;2,6-bis(azaniumyl)hexanoate |
| SMILES | [NH3+]C(CCC(=O)[O-])C(=O)[O-].[NH3+]CCCCC([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C6H14N2O2.C5H9NO4/c7-4-2-1-3-5(8)6(9)10;6-3(5(9)10)1-2-4(7)8/h5H,1-4,7-8H2,(H,9,10);3H,1-2,6H2,(H,7,8)(H,9,10) |
| InChIKey | HOMROMWVNDUGRI-UHFFFAOYSA-N |
| XLogP | -7.36 |
| TPSA | 203.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | -7.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|