About 6-azaniumylhexylazanium;pentanedioate
6-azaniumylhexylazanium;pentanedioate (PubChem CID 22482637) has the molecular formula C11H24N2O4
and a molecular weight of 248.32 g/mol. Its IUPAC name is 6-azaniumylhexylazanium;pentanedioate.
Molecular Properties
| Compound Name | 6-azaniumylhexylazanium;pentanedioate |
| PubChem CID | 22482637 |
| Molecular Formula | C11H24N2O4 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | 6-azaniumylhexylazanium;pentanedioate |
| SMILES | O=C([O-])CCCC(=O)[O-].[NH3+]CCCCCC[NH3+] |
| InChI | InChI=1S/C6H16N2.C5H8O4/c7-5-3-1-2-4-6-8;6-4(7)2-1-3-5(8)9/h1-8H2;1-3H2,(H,6,7)(H,8,9) |
| InChIKey | MZXDAWSEWVAFGB-UHFFFAOYSA-N |
| XLogP | -3.31 |
| TPSA | 135.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | -3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-azaniumylhexylazanium;pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-azaniumylhexylazanium;pentanedioate?
The IUPAC name of 6-azaniumylhexylazanium;pentanedioate (CID 22482637) is 6-azaniumylhexylazanium;pentanedioate.
What is the SMILES notation for 6-azaniumylhexylazanium;pentanedioate?
The canonical SMILES for 6-azaniumylhexylazanium;pentanedioate is O=C([O-])CCCC(=O)[O-].[NH3+]CCCCCC[NH3+].
What is the InChIKey of 6-azaniumylhexylazanium;pentanedioate?
The InChIKey is MZXDAWSEWVAFGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16N2.C5H8O4/c7-5-3-1-2-4-6-8;6-4(7)2-1-3-5(8)9/h1-8H2;1-3H2,(H,6,7)(H,8,9).
What are the key properties of 6-azaniumylhexylazanium;pentanedioate?
6-azaniumylhexylazanium;pentanedioate has a molecular weight of 248.32 g/mol, XLogP of -3.31, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-azaniumylhexylazanium;pentanedioate is sourced from PubChem (CID 22482637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).