About 2-[[(2S)-2,6-bis(azaniumyl)hexanoyl]amino]acetate
2-[[(2S)-2,6-bis(azaniumyl)hexanoyl]amino]acetate (PubChem CID 7022319) has the molecular formula C8H18N3O3+
and a molecular weight of 204.25 g/mol. Its IUPAC name is 2-[[(2S)-2,6-bis(azaniumyl)hexanoyl]amino]acetate.
Molecular Properties
| Compound Name | 2-[[(2S)-2,6-bis(azaniumyl)hexanoyl]amino]acetate |
| PubChem CID | 7022319 |
| Molecular Formula | C8H18N3O3+ |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 2-[[(2S)-2,6-bis(azaniumyl)hexanoyl]amino]acetate |
| SMILES | [NH3+]CCCC[C@H]([NH3+])C(=O)NCC(=O)[O-] |
| InChI | InChI=1S/C8H17N3O3/c9-4-2-1-3-6(10)8(14)11-5-7(12)13/h6H,1-5,9-10H2,(H,11,14)(H,12,13)/p+1/t6-/m0/s1 |
| InChIKey | HGNRJCINZYHNOU-LURJTMIESA-O |
| XLogP | -4.12 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | -4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(2S)-2,6-bis(azaniumyl)hexanoyl]amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(2S)-2,6-bis(azaniumyl)hexanoyl]amino]acetate?
The IUPAC name of 2-[[(2S)-2,6-bis(azaniumyl)hexanoyl]amino]acetate (CID 7022319) is 2-[[(2S)-2,6-bis(azaniumyl)hexanoyl]amino]acetate.
What is the SMILES notation for 2-[[(2S)-2,6-bis(azaniumyl)hexanoyl]amino]acetate?
The canonical SMILES for 2-[[(2S)-2,6-bis(azaniumyl)hexanoyl]amino]acetate is [NH3+]CCCC[C@H]([NH3+])C(=O)NCC(=O)[O-].
What is the InChIKey of 2-[[(2S)-2,6-bis(azaniumyl)hexanoyl]amino]acetate?
The InChIKey is HGNRJCINZYHNOU-LURJTMIESA-O. The full InChI is InChI=1S/C8H17N3O3/c9-4-2-1-3-6(10)8(14)11-5-7(12)13/h6H,1-5,9-10H2,(H,11,14)(H,12,13)/p+1/t6-/m0/s1.
What are the key properties of 2-[[(2S)-2,6-bis(azaniumyl)hexanoyl]amino]acetate?
2-[[(2S)-2,6-bis(azaniumyl)hexanoyl]amino]acetate has a molecular weight of 204.25 g/mol, XLogP of -4.12, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(2S)-2,6-bis(azaniumyl)hexanoyl]amino]acetate is sourced from PubChem (CID 7022319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).