C8H18N3O3+ — CID 7022319
2-[[(2S)-2,6-bis(azaniumyl)hexanoyl]amino]acetate (PubChem CID 7022319) has the molecular formula C8H18N3O3+ and a molecular weight of 204.25 g/mol. Its IUPAC name is 2-[[(2S)-2,6-bis(azaniumyl)hexanoyl]amino]acetate.
| Compound Name | 2-[[(2S)-2,6-bis(azaniumyl)hexanoyl]amino]acetate |
|---|---|
| PubChem CID | 7022319 |
| Molecular Formula | C8H18N3O3+ |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 2-[[(2S)-2,6-bis(azaniumyl)hexanoyl]amino]acetate |
| SMILES | [NH3+]CCCC[C@H]([NH3+])C(=O)NCC(=O)[O-] |
| InChI | InChI=1S/C8H17N3O3/c9-4-2-1-3-6(10)8(14)11-5-7(12)13/h6H,1-5,9-10H2,(H,11,14)(H,12,13)/p+1/t6-/m0/s1 |
| InChIKey | HGNRJCINZYHNOU-LURJTMIESA-O |
| XLogP | -4.12 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | -4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|