C9H14N3O6- — CID 6992508
(2S)-2-azaniumyl-5-[[2-(carboxylatomethylamino)-2-oxoethyl]amino]-5-oxopentanoate (PubChem CID 6992508) has the molecular formula C9H14N3O6- and a molecular weight of 260.23 g/mol. Its IUPAC name is (2S)-2-azaniumyl-5-[[2-(carboxylatomethylamino)-2-oxoethyl]amino]-5-oxopentanoate.
| Compound Name | (2S)-2-azaniumyl-5-[[2-(carboxylatomethylamino)-2-oxoethyl]amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 6992508 |
| Molecular Formula | C9H14N3O6- |
| Molecular Weight | 260.23 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | (2S)-2-azaniumyl-5-[[2-(carboxylatomethylamino)-2-oxoethyl]amino]-5-oxopentanoate |
| SMILES | [NH3+][C@@H](CCC(=O)NCC(=O)NCC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C9H15N3O6/c10-5(9(17)18)1-2-6(13)11-3-7(14)12-4-8(15)16/h5H,1-4,10H2,(H,11,13)(H,12,14)(H,15,16)(H,17,18)/p-1/t5-/m0/s1 |
| InChIKey | RWAZIEYJAWTKLB-YFKPBYRVSA-M |
| XLogP | -5.89 |
| TPSA | 166.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.23 |
| LogP ≤ 5 | -5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |