C8H12N3O6STc-3 — CID 76963456
oxygen(2-);2-[[2-[[2-[(2-sulfanylacetyl)amino]acetyl]amino]acetyl]amino]acetate;technetium-99 (PubChem CID 76963456) has the molecular formula C8H12N3O6STc-3 and a molecular weight of 377.17 g/mol. Its IUPAC name is oxygen(2-);2-[[2-[[2-[(2-sulfanylacetyl)amino]acetyl]amino]acetyl]amino]acetate;technetium-99.
| Compound Name | oxygen(2-);2-[[2-[[2-[(2-sulfanylacetyl)amino]acetyl]amino]acetyl]amino]acetate;technetium-99 |
|---|---|
| PubChem CID | 76963456 |
| Molecular Formula | C8H12N3O6STc-3 |
| Molecular Weight | 377.17 g/mol |
| Exact Mass | 376.95 |
| IUPAC Name | oxygen(2-);2-[[2-[[2-[(2-sulfanylacetyl)amino]acetyl]amino]acetyl]amino]acetate;technetium-99 |
| SMILES | O=C([O-])CNC(=O)CNC(=O)CNC(=O)CS.[99Tc].[O-2] |
| InChI | InChI=1S/C8H13N3O5S.O.Tc/c12-5(2-10-7(14)4-17)9-1-6(13)11-3-8(15)16;;/h17H,1-4H2,(H,9,12)(H,10,14)(H,11,13)(H,15,16);;/q;-2;/p-1/i;;1+1 |
| InChIKey | IJLMVQDZDAQSBQ-FCHARDOESA-M |
| XLogP | -4.11 |
| TPSA | 155.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.17 |
| LogP ≤ 5 | -4.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|