About azanium 2-sulfanylacetate
azanium 2-sulfanylacetate (PubChem CID 21534) has the molecular formula C2H7NO2S
and a molecular weight of 109.15 g/mol. Its IUPAC name is azanium 2-sulfanylacetate.
Molecular Properties
| Compound Name | azanium 2-sulfanylacetate |
| PubChem CID | 21534 |
| Molecular Formula | C2H7NO2S |
| Molecular Weight | 109.15 g/mol |
| Exact Mass | 109.02 |
| IUPAC Name | azanium 2-sulfanylacetate |
| SMILES | O=C([O-])CS.[NH4+] |
| InChI | InChI=1S/C2H4O2S.H3N/c3-2(4)1-5;/h5H,1H2,(H,3,4);1H3 |
| InChIKey | ZZTCCAPMZLDHFM-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.15 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze azanium 2-sulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium 2-sulfanylacetate?
The IUPAC name of azanium 2-sulfanylacetate (CID 21534) is azanium 2-sulfanylacetate.
What is the SMILES notation for azanium 2-sulfanylacetate?
The canonical SMILES for azanium 2-sulfanylacetate is O=C([O-])CS.[NH4+].
What is the InChIKey of azanium 2-sulfanylacetate?
The InChIKey is ZZTCCAPMZLDHFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O2S.H3N/c3-2(4)1-5;/h5H,1H2,(H,3,4);1H3.
What are the key properties of azanium 2-sulfanylacetate?
azanium 2-sulfanylacetate has a molecular weight of 109.15 g/mol, XLogP of -0.96, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azanium 2-sulfanylacetate is sourced from PubChem (CID 21534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).