About 2-sulfanylacetate;tributylstannanylium
2-sulfanylacetate;tributylstannanylium (PubChem CID 161006550) has the molecular formula C14H30O2SSn
and a molecular weight of 381.17 g/mol. Its IUPAC name is 2-sulfanylacetate;tributylstannanylium.
Molecular Properties
| Compound Name | 2-sulfanylacetate;tributylstannanylium |
| PubChem CID | 161006550 |
| Molecular Formula | C14H30O2SSn |
| Molecular Weight | 381.17 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 2-sulfanylacetate;tributylstannanylium |
| SMILES | CCCC[Sn+](CCCC)CCCC.O=C([O-])CS |
| InChI | InChI=1S/3C4H9.C2H4O2S.Sn/c3*1-3-4-2;3-2(4)1-5;/h3*1,3-4H2,2H3;5H,1H2,(H,3,4);/q;;;;+1/p-1 |
| InChIKey | TWOQBRRSNSXUBV-UHFFFAOYSA-M |
| XLogP | 3.55 |
| TPSA | 40.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.17 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfanylacetate;tributylstannanylium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfanylacetate;tributylstannanylium?
The IUPAC name of 2-sulfanylacetate;tributylstannanylium (CID 161006550) is 2-sulfanylacetate;tributylstannanylium.
What is the SMILES notation for 2-sulfanylacetate;tributylstannanylium?
The canonical SMILES for 2-sulfanylacetate;tributylstannanylium is CCCC[Sn+](CCCC)CCCC.O=C([O-])CS.
What is the InChIKey of 2-sulfanylacetate;tributylstannanylium?
The InChIKey is TWOQBRRSNSXUBV-UHFFFAOYSA-M. The full InChI is InChI=1S/3C4H9.C2H4O2S.Sn/c3*1-3-4-2;3-2(4)1-5;/h3*1,3-4H2,2H3;5H,1H2,(H,3,4);/q;;;;+1/p-1.
What are the key properties of 2-sulfanylacetate;tributylstannanylium?
2-sulfanylacetate;tributylstannanylium has a molecular weight of 381.17 g/mol, XLogP of 3.55, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfanylacetate;tributylstannanylium is sourced from PubChem (CID 161006550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).