About copper(1+);bis(tributylstannanylium)
copper(1+);bis(tributylstannanylium) (PubChem CID 19840058) has the molecular formula C24H54CuSn2+3
and a molecular weight of 643.66 g/mol. Its IUPAC name is copper(1+);bis(tributylstannanylium).
Molecular Properties
| Compound Name | copper(1+);bis(tributylstannanylium) |
| PubChem CID | 19840058 |
| Molecular Formula | C24H54CuSn2+3 |
| Molecular Weight | 643.66 g/mol |
| Exact Mass | 645.15 |
| IUPAC Name | copper(1+);bis(tributylstannanylium) |
| SMILES | CCCC[Sn+](CCCC)CCCC.CCCC[Sn+](CCCC)CCCC.[Cu+] |
| InChI | InChI=1S/6C4H9.Cu.2Sn/c6*1-3-4-2;;;/h6*1,3-4H2,2H3;;;/q;;;;;;3*+1 |
| InChIKey | VUUNEKXYJKNWOU-UHFFFAOYSA-N |
| XLogP | 9.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 643.66 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze copper(1+);bis(tributylstannanylium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper(1+);bis(tributylstannanylium)?
The IUPAC name of copper(1+);bis(tributylstannanylium) (CID 19840058) is copper(1+);bis(tributylstannanylium).
What is the SMILES notation for copper(1+);bis(tributylstannanylium)?
The canonical SMILES for copper(1+);bis(tributylstannanylium) is CCCC[Sn+](CCCC)CCCC.CCCC[Sn+](CCCC)CCCC.[Cu+].
What is the InChIKey of copper(1+);bis(tributylstannanylium)?
The InChIKey is VUUNEKXYJKNWOU-UHFFFAOYSA-N. The full InChI is InChI=1S/6C4H9.Cu.2Sn/c6*1-3-4-2;;;/h6*1,3-4H2,2H3;;;/q;;;;;;3*+1.
What are the key properties of copper(1+);bis(tributylstannanylium)?
copper(1+);bis(tributylstannanylium) has a molecular weight of 643.66 g/mol, XLogP of 9.76, 18 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for copper(1+);bis(tributylstannanylium) is sourced from PubChem (CID 19840058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).