dibutyl(propyl)stannanylium chloride

C11H25ClSn — CID 23200296

IUPACdibutyl(propyl)stannanylium chloride
SMILESCCCC[Sn+](CCC)CCCC.[Cl-]
InChIInChI=1S/2C4H9.C3H7.ClH.Sn/c2*1-3-4-2;1-3-2;;/h2*1,3-4H2,2H3;1,3H2,2H3;1H;/q;;;;+1/p-1
InChIKeySYLYVEDXOYCHST-UHFFFAOYSA-M
MW311.49 g/mol
LogP1.50
Rot. Bonds8

About dibutyl(propyl)stannanylium chloride

dibutyl(propyl)stannanylium chloride (PubChem CID 23200296) has the molecular formula C11H25ClSn and a molecular weight of 311.49 g/mol. Its IUPAC name is dibutyl(propyl)stannanylium chloride.

Molecular Properties

Compound Namedibutyl(propyl)stannanylium chloride
PubChem CID23200296
Molecular FormulaC11H25ClSn
Molecular Weight311.49 g/mol
Exact Mass312.07
IUPAC Namedibutyl(propyl)stannanylium chloride
SMILESCCCC[Sn+](CCC)CCCC.[Cl-]
InChIInChI=1S/2C4H9.C3H7.ClH.Sn/c2*1-3-4-2;1-3-2;;/h2*1,3-4H2,2H3;1,3H2,2H3;1H;/q;;;;+1/p-1
InChIKeySYLYVEDXOYCHST-UHFFFAOYSA-M
XLogP1.50
TPSA0.00 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds8
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500311.49
LogP ≤ 51.50
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Analyze dibutyl(propyl)stannanylium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of dibutyl(propyl)stannanylium chloride?
The IUPAC name of dibutyl(propyl)stannanylium chloride (CID 23200296) is dibutyl(propyl)stannanylium chloride.
What is the SMILES notation for dibutyl(propyl)stannanylium chloride?
The canonical SMILES for dibutyl(propyl)stannanylium chloride is CCCC[Sn+](CCC)CCCC.[Cl-].
What is the InChIKey of dibutyl(propyl)stannanylium chloride?
The InChIKey is SYLYVEDXOYCHST-UHFFFAOYSA-M. The full InChI is InChI=1S/2C4H9.C3H7.ClH.Sn/c2*1-3-4-2;1-3-2;;/h2*1,3-4H2,2H3;1,3H2,2H3;1H;/q;;;;+1/p-1.
What are the key properties of dibutyl(propyl)stannanylium chloride?
dibutyl(propyl)stannanylium chloride has a molecular weight of 311.49 g/mol, XLogP of 1.50, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dibutyl(propyl)stannanylium chloride is sourced from PubChem (CID 23200296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).