About methanolate;trioctylstannanylium
methanolate;trioctylstannanylium (PubChem CID 23295104) has the molecular formula C25H54OSn
and a molecular weight of 489.42 g/mol. Its IUPAC name is methanolate;trioctylstannanylium.
Molecular Properties
| Compound Name | methanolate;trioctylstannanylium |
| PubChem CID | 23295104 |
| Molecular Formula | C25H54OSn |
| Molecular Weight | 489.42 g/mol |
| Exact Mass | 490.32 |
| IUPAC Name | methanolate;trioctylstannanylium |
| SMILES | CCCCCCCC[Sn+](CCCCCCCC)CCCCCCCC.C[O-] |
| InChI | InChI=1S/3C8H17.CH3O.Sn/c3*1-3-5-7-8-6-4-2;1-2;/h3*1,3-8H2,2H3;1H3;/q;;;-1;+1 |
| InChIKey | ITYWAQTXWQOHHD-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 489.42 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methanolate;trioctylstannanylium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanolate;trioctylstannanylium?
The IUPAC name of methanolate;trioctylstannanylium (CID 23295104) is methanolate;trioctylstannanylium.
What is the SMILES notation for methanolate;trioctylstannanylium?
The canonical SMILES for methanolate;trioctylstannanylium is CCCCCCCC[Sn+](CCCCCCCC)CCCCCCCC.C[O-].
What is the InChIKey of methanolate;trioctylstannanylium?
The InChIKey is ITYWAQTXWQOHHD-UHFFFAOYSA-N. The full InChI is InChI=1S/3C8H17.CH3O.Sn/c3*1-3-5-7-8-6-4-2;1-2;/h3*1,3-8H2,2H3;1H3;/q;;;-1;+1.
What are the key properties of methanolate;trioctylstannanylium?
methanolate;trioctylstannanylium has a molecular weight of 489.42 g/mol, XLogP of 8.54, 21 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methanolate;trioctylstannanylium is sourced from PubChem (CID 23295104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).