C27H57NS2Sn — CID 20561757
N,N-dimethylcarbamodithioate;trioctylstannanylium (PubChem CID 20561757) has the molecular formula C27H57NS2Sn and a molecular weight of 578.61 g/mol. Its IUPAC name is N,N-dimethylcarbamodithioate;trioctylstannanylium.
| Compound Name | N,N-dimethylcarbamodithioate;trioctylstannanylium |
|---|---|
| PubChem CID | 20561757 |
| Molecular Formula | C27H57NS2Sn |
| Molecular Weight | 578.61 g/mol |
| Exact Mass | 579.30 |
| IUPAC Name | N,N-dimethylcarbamodithioate;trioctylstannanylium |
| SMILES | CCCCCCCC[Sn+](CCCCCCCC)CCCCCCCC.CN(C)C(=S)[S-] |
| InChI | InChI=1S/3C8H17.C3H7NS2.Sn/c3*1-3-5-7-8-6-4-2;1-4(2)3(5)6;/h3*1,3-8H2,2H3;1-2H3,(H,5,6);/q;;;;+1/p-1 |
| InChIKey | UUDPAVCZSNUWEJ-UHFFFAOYSA-M |
| XLogP | 9.94 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.61 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|