C3H6KNS2 — CID 23662387
potassium N,N-dimethylcarbamodithioate (PubChem CID 23662387) has the molecular formula C3H6KNS2 and a molecular weight of 159.32 g/mol. Its IUPAC name is potassium N,N-dimethylcarbamodithioate.
| Compound Name | potassium N,N-dimethylcarbamodithioate |
|---|---|
| PubChem CID | 23662387 |
| Molecular Formula | C3H6KNS2 |
| Molecular Weight | 159.32 g/mol |
| Exact Mass | 158.96 |
| IUPAC Name | potassium N,N-dimethylcarbamodithioate |
| SMILES | CN(C)C(=S)[S-].[K+] |
| InChI | InChI=1S/C3H7NS2.K/c1-4(2)3(5)6;/h1-2H3,(H,5,6);/q;+1/p-1 |
| InChIKey | TVPFLPJBESCUKI-UHFFFAOYSA-M |
| XLogP | -2.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.32 |
| LogP ≤ 5 | -2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|