C7H14N2S4Zn — CID 149053660
zinc;3-(dimethylamino)thiirane-2-thiolate;N,N-dimethylcarbamodithioate (PubChem CID 149053660) has the molecular formula C7H14N2S4Zn and a molecular weight of 319.86 g/mol. Its IUPAC name is zinc;3-(dimethylamino)thiirane-2-thiolate;N,N-dimethylcarbamodithioate.
| Compound Name | zinc;3-(dimethylamino)thiirane-2-thiolate;N,N-dimethylcarbamodithioate |
|---|---|
| PubChem CID | 149053660 |
| Molecular Formula | C7H14N2S4Zn |
| Molecular Weight | 319.86 g/mol |
| Exact Mass | 317.93 |
| IUPAC Name | zinc;3-(dimethylamino)thiirane-2-thiolate;N,N-dimethylcarbamodithioate |
| SMILES | CN(C)C(=S)[S-].CN(C)C1SC1[S-].[Zn+2] |
| InChI | InChI=1S/C4H9NS2.C3H7NS2.Zn/c1-5(2)3-4(6)7-3;1-4(2)3(5)6;/h3-4,6H,1-2H3;1-2H3,(H,5,6);/q;;+2/p-2 |
| InChIKey | QKHMSDNFLOQCQH-UHFFFAOYSA-L |
| XLogP | 0.87 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.86 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|