C9H18FeN3O2S6 — CID 134094508
dimethylamino(sulfanylidene)methanesulfinate;bis(N,N-dimethylcarbamodithioate);iron(3+) (PubChem CID 134094508) has the molecular formula C9H18FeN3O2S6 and a molecular weight of 448.51 g/mol. Its IUPAC name is dimethylamino(sulfanylidene)methanesulfinate;bis(N,N-dimethylcarbamodithioate);iron(3+).
| Compound Name | dimethylamino(sulfanylidene)methanesulfinate;bis(N,N-dimethylcarbamodithioate);iron(3+) |
|---|---|
| PubChem CID | 134094508 |
| Molecular Formula | C9H18FeN3O2S6 |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 447.91 |
| IUPAC Name | dimethylamino(sulfanylidene)methanesulfinate;bis(N,N-dimethylcarbamodithioate);iron(3+) |
| SMILES | CN(C)C(=S)S(=O)[O-].CN(C)C(=S)[S-].CN(C)C(=S)[S-].[Fe+3] |
| InChI | InChI=1S/C3H7NO2S2.2C3H7NS2.Fe/c1-4(2)3(7)8(5)6;2*1-4(2)3(5)6;/h1-2H3,(H,5,6);2*1-2H3,(H,5,6);/q;;;+3/p-3 |
| InChIKey | AKLVLKXIWPSPRP-UHFFFAOYSA-K |
| XLogP | 0.47 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|