About octadecanoate;trioctylstannanylium
octadecanoate;trioctylstannanylium (PubChem CID 23208965) has the molecular formula C42H86O2Sn
and a molecular weight of 741.86 g/mol. Its IUPAC name is octadecanoate;trioctylstannanylium.
Molecular Properties
| Compound Name | octadecanoate;trioctylstannanylium |
| PubChem CID | 23208965 |
| Molecular Formula | C42H86O2Sn |
| Molecular Weight | 741.86 g/mol |
| Exact Mass | 742.56 |
| IUPAC Name | octadecanoate;trioctylstannanylium |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)[O-].CCCCCCCC[Sn+](CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C18H36O2.3C8H17.Sn/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;3*1-3-5-7-8-6-4-2;/h2-17H2,1H3,(H,19,20);3*1,3-8H2,2H3;/q;;;;+1/p-1 |
| InChIKey | LZXCBAFJOXLGRV-UHFFFAOYSA-M |
| XLogP | 14.56 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 741.86 |
| LogP ≤ 5 | 14.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze octadecanoate;trioctylstannanylium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octadecanoate;trioctylstannanylium?
The IUPAC name of octadecanoate;trioctylstannanylium (CID 23208965) is octadecanoate;trioctylstannanylium.
What is the SMILES notation for octadecanoate;trioctylstannanylium?
The canonical SMILES for octadecanoate;trioctylstannanylium is CCCCCCCCCCCCCCCCCC(=O)[O-].CCCCCCCC[Sn+](CCCCCCCC)CCCCCCCC.
What is the InChIKey of octadecanoate;trioctylstannanylium?
The InChIKey is LZXCBAFJOXLGRV-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H36O2.3C8H17.Sn/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;3*1-3-5-7-8-6-4-2;/h2-17H2,1H3,(H,19,20);3*1,3-8H2,2H3;/q;;;;+1/p-1.
What are the key properties of octadecanoate;trioctylstannanylium?
octadecanoate;trioctylstannanylium has a molecular weight of 741.86 g/mol, XLogP of 14.56, 37 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for octadecanoate;trioctylstannanylium is sourced from PubChem (CID 23208965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).