About sulfanide;tributylstannanylium
sulfanide;tributylstannanylium (PubChem CID 13070078) has the molecular formula C12H28SSn
and a molecular weight of 323.13 g/mol. Its IUPAC name is sulfanide;tributylstannanylium.
Molecular Properties
| Compound Name | sulfanide;tributylstannanylium |
| PubChem CID | 13070078 |
| Molecular Formula | C12H28SSn |
| Molecular Weight | 323.13 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | sulfanide;tributylstannanylium |
| SMILES | CCCC[Sn+](CCCC)CCCC.[SH-] |
| InChI | InChI=1S/3C4H9.H2S.Sn/c3*1-3-4-2;;/h3*1,3-4H2,2H3;1H2;/q;;;;+1/p-1 |
| InChIKey | HCELHEKWMYQQPU-UHFFFAOYSA-M |
| XLogP | 4.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.13 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze sulfanide;tributylstannanylium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfanide;tributylstannanylium?
The IUPAC name of sulfanide;tributylstannanylium (CID 13070078) is sulfanide;tributylstannanylium.
What is the SMILES notation for sulfanide;tributylstannanylium?
The canonical SMILES for sulfanide;tributylstannanylium is CCCC[Sn+](CCCC)CCCC.[SH-].
What is the InChIKey of sulfanide;tributylstannanylium?
The InChIKey is HCELHEKWMYQQPU-UHFFFAOYSA-M. The full InChI is InChI=1S/3C4H9.H2S.Sn/c3*1-3-4-2;;/h3*1,3-4H2,2H3;1H2;/q;;;;+1/p-1.
What are the key properties of sulfanide;tributylstannanylium?
sulfanide;tributylstannanylium has a molecular weight of 323.13 g/mol, XLogP of 4.61, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sulfanide;tributylstannanylium is sourced from PubChem (CID 13070078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).