About tributyl(chloro)stannane;tributylstannanylium;chloride
tributyl(chloro)stannane;tributylstannanylium;chloride (PubChem CID 89264041) has the molecular formula C24H54Cl2Sn2
and a molecular weight of 651.02 g/mol. Its IUPAC name is tributyl(chloro)stannane;tributylstannanylium;chloride.
Molecular Properties
| Compound Name | tributyl(chloro)stannane;tributylstannanylium;chloride |
| PubChem CID | 89264041 |
| Molecular Formula | C24H54Cl2Sn2 |
| Molecular Weight | 651.02 g/mol |
| Exact Mass | 652.16 |
| IUPAC Name | tributyl(chloro)stannane;tributylstannanylium;chloride |
| SMILES | CCCC[Sn+](CCCC)CCCC.CCCC[Sn](Cl)(CCCC)CCCC.[Cl-] |
| InChI | InChI=1S/6C4H9.2ClH.2Sn/c6*1-3-4-2;;;;/h6*1,3-4H2,2H3;2*1H;;/q;;;;;;;;2*+1/p-2 |
| InChIKey | RMMJGVZABJBVIZ-UHFFFAOYSA-L |
| XLogP | 7.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 651.02 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze tributyl(chloro)stannane;tributylstannanylium;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributyl(chloro)stannane;tributylstannanylium;chloride?
The IUPAC name of tributyl(chloro)stannane;tributylstannanylium;chloride (CID 89264041) is tributyl(chloro)stannane;tributylstannanylium;chloride.
What is the SMILES notation for tributyl(chloro)stannane;tributylstannanylium;chloride?
The canonical SMILES for tributyl(chloro)stannane;tributylstannanylium;chloride is CCCC[Sn+](CCCC)CCCC.CCCC[Sn](Cl)(CCCC)CCCC.[Cl-].
What is the InChIKey of tributyl(chloro)stannane;tributylstannanylium;chloride?
The InChIKey is RMMJGVZABJBVIZ-UHFFFAOYSA-L. The full InChI is InChI=1S/6C4H9.2ClH.2Sn/c6*1-3-4-2;;;;/h6*1,3-4H2,2H3;2*1H;;/q;;;;;;;;2*+1/p-2.
What are the key properties of tributyl(chloro)stannane;tributylstannanylium;chloride?
tributyl(chloro)stannane;tributylstannanylium;chloride has a molecular weight of 651.02 g/mol, XLogP of 7.46, 18 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tributyl(chloro)stannane;tributylstannanylium;chloride is sourced from PubChem (CID 89264041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).