About dibutyl(dichloro)stannane;dihydrochloride
dibutyl(dichloro)stannane;dihydrochloride (PubChem CID 174960716) has the molecular formula C8H20Cl4Sn
and a molecular weight of 376.77 g/mol. Its IUPAC name is dibutyl(dichloro)stannane;dihydrochloride.
Molecular Properties
| Compound Name | dibutyl(dichloro)stannane;dihydrochloride |
| PubChem CID | 174960716 |
| Molecular Formula | C8H20Cl4Sn |
| Molecular Weight | 376.77 g/mol |
| Exact Mass | 375.93 |
| IUPAC Name | dibutyl(dichloro)stannane;dihydrochloride |
| SMILES | CCCC[Sn](Cl)(Cl)CCCC.Cl.Cl |
| InChI | InChI=1S/2C4H9.4ClH.Sn/c2*1-3-4-2;;;;;/h2*1,3-4H2,2H3;4*1H;/q;;;;;;+2/p-2 |
| InChIKey | SQUBQCQRZKKMOG-UHFFFAOYSA-L |
| XLogP | 5.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.77 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze dibutyl(dichloro)stannane;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibutyl(dichloro)stannane;dihydrochloride?
The IUPAC name of dibutyl(dichloro)stannane;dihydrochloride (CID 174960716) is dibutyl(dichloro)stannane;dihydrochloride.
What is the SMILES notation for dibutyl(dichloro)stannane;dihydrochloride?
The canonical SMILES for dibutyl(dichloro)stannane;dihydrochloride is CCCC[Sn](Cl)(Cl)CCCC.Cl.Cl.
What is the InChIKey of dibutyl(dichloro)stannane;dihydrochloride?
The InChIKey is SQUBQCQRZKKMOG-UHFFFAOYSA-L. The full InChI is InChI=1S/2C4H9.4ClH.Sn/c2*1-3-4-2;;;;;/h2*1,3-4H2,2H3;4*1H;/q;;;;;;+2/p-2.
What are the key properties of dibutyl(dichloro)stannane;dihydrochloride?
dibutyl(dichloro)stannane;dihydrochloride has a molecular weight of 376.77 g/mol, XLogP of 5.35, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dibutyl(dichloro)stannane;dihydrochloride is sourced from PubChem (CID 174960716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).