About tributylstannanylium formate
tributylstannanylium formate (PubChem CID 22167734) has the molecular formula C13H28O2Sn
and a molecular weight of 335.08 g/mol. Its IUPAC name is tributylstannanylium formate.
Molecular Properties
| Compound Name | tributylstannanylium formate |
| PubChem CID | 22167734 |
| Molecular Formula | C13H28O2Sn |
| Molecular Weight | 335.08 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | tributylstannanylium formate |
| SMILES | CCCC[Sn+](CCCC)CCCC.O=C[O-] |
| InChI | InChI=1S/3C4H9.CH2O2.Sn/c3*1-3-4-2;2-1-3;/h3*1,3-4H2,2H3;1H,(H,2,3);/q;;;;+1/p-1 |
| InChIKey | POUGAXCXKDLEMK-UHFFFAOYSA-M |
| XLogP | 3.25 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.08 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze tributylstannanylium formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributylstannanylium formate?
The IUPAC name of tributylstannanylium formate (CID 22167734) is tributylstannanylium formate.
What is the SMILES notation for tributylstannanylium formate?
The canonical SMILES for tributylstannanylium formate is CCCC[Sn+](CCCC)CCCC.O=C[O-].
What is the InChIKey of tributylstannanylium formate?
The InChIKey is POUGAXCXKDLEMK-UHFFFAOYSA-M. The full InChI is InChI=1S/3C4H9.CH2O2.Sn/c3*1-3-4-2;2-1-3;/h3*1,3-4H2,2H3;1H,(H,2,3);/q;;;;+1/p-1.
What are the key properties of tributylstannanylium formate?
tributylstannanylium formate has a molecular weight of 335.08 g/mol, XLogP of 3.25, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tributylstannanylium formate is sourced from PubChem (CID 22167734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).