About tributylstannanylium sulfamate
tributylstannanylium sulfamate (PubChem CID 175434161) has the molecular formula C12H29NO3SSn
and a molecular weight of 386.15 g/mol. Its IUPAC name is tributylstannanylium sulfamate.
Molecular Properties
| Compound Name | tributylstannanylium sulfamate |
| PubChem CID | 175434161 |
| Molecular Formula | C12H29NO3SSn |
| Molecular Weight | 386.15 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | tributylstannanylium sulfamate |
| SMILES | CCCC[Sn+](CCCC)CCCC.NS(=O)(=O)[O-] |
| InChI | InChI=1S/3C4H9.H3NO3S.Sn/c3*1-3-4-2;1-5(2,3)4;/h3*1,3-4H2,2H3;(H3,1,2,3,4);/q;;;;+1/p-1 |
| InChIKey | AYFVIIACGSIVPM-UHFFFAOYSA-M |
| XLogP | 3.29 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.15 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze tributylstannanylium sulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributylstannanylium sulfamate?
The IUPAC name of tributylstannanylium sulfamate (CID 175434161) is tributylstannanylium sulfamate.
What is the SMILES notation for tributylstannanylium sulfamate?
The canonical SMILES for tributylstannanylium sulfamate is CCCC[Sn+](CCCC)CCCC.NS(=O)(=O)[O-].
What is the InChIKey of tributylstannanylium sulfamate?
The InChIKey is AYFVIIACGSIVPM-UHFFFAOYSA-M. The full InChI is InChI=1S/3C4H9.H3NO3S.Sn/c3*1-3-4-2;1-5(2,3)4;/h3*1,3-4H2,2H3;(H3,1,2,3,4);/q;;;;+1/p-1.
What are the key properties of tributylstannanylium sulfamate?
tributylstannanylium sulfamate has a molecular weight of 386.15 g/mol, XLogP of 3.29, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tributylstannanylium sulfamate is sourced from PubChem (CID 175434161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).