About methanesulfonate;tripropylstannanylium
methanesulfonate;tripropylstannanylium (PubChem CID 161250747) has the molecular formula C10H24O3SSn
and a molecular weight of 343.08 g/mol. Its IUPAC name is methanesulfonate;tripropylstannanylium.
Molecular Properties
| Compound Name | methanesulfonate;tripropylstannanylium |
| PubChem CID | 161250747 |
| Molecular Formula | C10H24O3SSn |
| Molecular Weight | 343.08 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | methanesulfonate;tripropylstannanylium |
| SMILES | CCC[Sn+](CCC)CCC.CS(=O)(=O)[O-] |
| InChI | InChI=1S/3C3H7.CH4O3S.Sn/c3*1-3-2;1-5(2,3)4;/h3*1,3H2,2H3;1H3,(H,2,3,4);/q;;;;+1/p-1 |
| InChIKey | VBFTVBAFLLCULS-UHFFFAOYSA-M |
| XLogP | 2.87 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.08 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze methanesulfonate;tripropylstannanylium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanesulfonate;tripropylstannanylium?
The IUPAC name of methanesulfonate;tripropylstannanylium (CID 161250747) is methanesulfonate;tripropylstannanylium.
What is the SMILES notation for methanesulfonate;tripropylstannanylium?
The canonical SMILES for methanesulfonate;tripropylstannanylium is CCC[Sn+](CCC)CCC.CS(=O)(=O)[O-].
What is the InChIKey of methanesulfonate;tripropylstannanylium?
The InChIKey is VBFTVBAFLLCULS-UHFFFAOYSA-M. The full InChI is InChI=1S/3C3H7.CH4O3S.Sn/c3*1-3-2;1-5(2,3)4;/h3*1,3H2,2H3;1H3,(H,2,3,4);/q;;;;+1/p-1.
What are the key properties of methanesulfonate;tripropylstannanylium?
methanesulfonate;tripropylstannanylium has a molecular weight of 343.08 g/mol, XLogP of 2.87, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanesulfonate;tripropylstannanylium is sourced from PubChem (CID 161250747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).